Products 1357455-93-6
CAS 1357455-93-6 is the registry number for N-(2-Chloroacetyl)-L-tyrosine cyanomethyl ester, 97%, 97%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
Cyanomethyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-hydroxyphenyl)propanoate (CAS 1357455-93-6) is a chemical compound with the molecular formula C13H13ClN2O4 and a molecular weight of 296.70 g/mol. IUPAC name: cyanomethyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-hydroxyphenyl)propanoate. InChIKey: RBJOVQIJNJHJIS-LLVKDONJSA-N.
| Molecular formula | C13H13ClN2O4 |
|---|---|
| Molecular weight | 296.70 g/mol |
| IUPAC name | cyanomethyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-hydroxyphenyl)propanoate |
| InChIKey | RBJOVQIJNJHJIS-LLVKDONJSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)OCC#N)NC(=O)CCl)O |
Computed by PubChem (NCBI)