CAS 1189105-82-5 is the registry number for Ethyl 4-chloro-6,7-dimethoxyquinazoline-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 4-chloro-6,7-dimethoxyquinazoline-2-carboxylate (CAS 1189105-82-5) is a chemical compound with the molecular formula C13H13ClN2O4 and a molecular weight of 296.70 g/mol. IUPAC name: ethyl 4-chloro-6,7-dimethoxyquinazoline-2-carboxylate. InChIKey: KPLJFJYTEIHSAV-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O4 |
|---|---|
| Molecular weight | 296.70 g/mol |
| IUPAC name | ethyl 4-chloro-6,7-dimethoxyquinazoline-2-carboxylate |
| InChIKey | KPLJFJYTEIHSAV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=CC(=C(C=C2C(=N1)Cl)OC)OC |
Computed by PubChem (NCBI)