CAS 1974746-64-9 is the registry number for 4-Chloro-6,7-diethoxy-3-nitroquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-chloro-6,7-diethoxy-3-nitroquinoline (CAS 1974746-64-9) is a chemical compound with the molecular formula C13H13ClN2O4 and a molecular weight of 296.70 g/mol. IUPAC name: 4-chloro-6,7-diethoxy-3-nitroquinoline. InChIKey: YZRSGIQPJASFGY-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O4 |
|---|---|
| Molecular weight | 296.70 g/mol |
| IUPAC name | 4-chloro-6,7-diethoxy-3-nitroquinoline |
| InChIKey | YZRSGIQPJASFGY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)C(=C(C=N2)[N+](=O)[O-])Cl)OCC |
Computed by PubChem (NCBI)