CAS 13575-72-9 appears in our catalog under these names: trans-2-Amino-2,3-dihydro-1H-inden-1-ol, 97%, 2-Aminoindan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg.
(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-ol (CAS 13575-72-9) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (1R,2R)-2-amino-2,3-dihydro-1H-inden-1-ol. InChIKey: HRWCWYGWEVVDLT-RKDXNWHRSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (1R,2R)-2-amino-2,3-dihydro-1H-inden-1-ol |
| InChIKey | HRWCWYGWEVVDLT-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H](C2=CC=CC=C21)O)N |
Computed by PubChem (NCBI)