CAS 23337-80-6 appears in our catalog under these names: (+/-)-Cis-2-amino-1-hydroxyindane, 95%, rac-(1R,2S)-2-Amino-2,3-dihydro-1H-inden-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-ol (CAS 23337-80-6) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (1S,2R)-2-amino-2,3-dihydro-1H-inden-1-ol. InChIKey: HRWCWYGWEVVDLT-BDAKNGLRSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (1S,2R)-2-amino-2,3-dihydro-1H-inden-1-ol |
| InChIKey | HRWCWYGWEVVDLT-BDAKNGLRSA-N |
| SMILES | C1[C@H]([C@H](C2=CC=CC=C21)O)N |
Computed by PubChem (NCBI)