CAS 135779-82-7 appears in our catalog under these names: Bamaquimast, 98%, Bamaquimast/ 98.4% (existing batch purity), Bamaquimast (F 10126), Bamaquimast, Bamaquimast, 98.47% ,, 98.47% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 1mg, 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg.
3-(3-oxo-4-propylquinoxalin-2-yl)propyl N-methylcarbamate (CAS 135779-82-7) is a chemical compound with the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. IUPAC name: 3-(3-oxo-4-propylquinoxalin-2-yl)propyl N-methylcarbamate. InChIKey: HNQSZPBGDAJIJO-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O3 |
|---|---|
| Molecular weight | 303.36 g/mol |
| IUPAC name | 3-(3-oxo-4-propylquinoxalin-2-yl)propyl N-methylcarbamate |
| InChIKey | HNQSZPBGDAJIJO-UHFFFAOYSA-N |
| SMILES | CCCN1C2=CC=CC=C2N=C(C1=O)CCCOC(=O)NC |
Computed by PubChem (NCBI)