CAS 135782-26-2 appears in our catalog under these names: Ethyl 4–Benzyl–2–morpholinecarboxylate Hydrochloride, Ethyl 4-benzylmorpholine-2-carboxylate hydrochloride, Ethyl 4-benzyl-2-morpholinecarboxylate hydrochloride, 97%, Ethyl 4-Benzyl-2-morpholinecarboxylate Hydrochloride, 97+%, Ethyl 4-benzyl-2-morpholinecarboxylate, HCl, >97%, >97%. Offered by: GLPBio, Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Ethyl 4-benzylmorpholine-2-carboxylate;hydrochloride (CAS 135782-26-2) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 285.76 g/mol. IUPAC name: ethyl 4-benzylmorpholine-2-carboxylate;hydrochloride. InChIKey: OJZLYOLEHIUKPS-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 285.76 g/mol |
| IUPAC name | ethyl 4-benzylmorpholine-2-carboxylate;hydrochloride |
| InChIKey | OJZLYOLEHIUKPS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CCO1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)