Products 848044-18-8
CAS 848044-18-8 is the registry number for (R)-tert-Butyl 2-amino-3-(3-chloro-4-methoxyphenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
Tert-butyl (2R)-2-amino-3-(3-chloro-4-methoxyphenyl)propanoate (CAS 848044-18-8) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 285.76 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-(3-chloro-4-methoxyphenyl)propanoate. InChIKey: JDCASFGCLDBBSC-LLVKDONJSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 285.76 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-(3-chloro-4-methoxyphenyl)propanoate |
| InChIKey | JDCASFGCLDBBSC-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CC1=CC(=C(C=C1)OC)Cl)N |
Computed by PubChem (NCBI)