Products 135813-39-7

CAS 135813-39-7 is the registry number for 2-Ethyl-5,6-dihydro-1,4-oxathiine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-ethyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid (CAS 135813-39-7) is a chemical compound with the molecular formula C7H10O3S and a molecular weight of 174.22 g/mol. IUPAC name: 6-ethyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid. InChIKey: GZSSVTISFWIFHB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O3S
Molecular weight174.22 g/mol
IUPAC name6-ethyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid
InChIKeyGZSSVTISFWIFHB-UHFFFAOYSA-N
SMILESCCC1=C(SCCO1)C(=O)O

Computed by PubChem (NCBI)