Products 2470279-35-5
CAS 2470279-35-5 is the registry number for (3AS,6aS)-3a-(hydroxymethyl)tetrahydro-1H,3H-thieno[3,4-c]furan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,6aS)-6a-(hydroxymethyl)-1,3a,4,6-tetrahydrothieno[3,4-c]furan-3-one (CAS 2470279-35-5) is a chemical compound with the molecular formula C7H10O3S and a molecular weight of 174.22 g/mol. IUPAC name: (3aS,6aS)-6a-(hydroxymethyl)-1,3a,4,6-tetrahydrothieno[3,4-c]furan-3-one. InChIKey: JMCSZJQCCQAIOI-IYSWYEEDSA-N.
| Molecular formula | C7H10O3S |
|---|---|
| Molecular weight | 174.22 g/mol |
| IUPAC name | (3aS,6aS)-6a-(hydroxymethyl)-1,3a,4,6-tetrahydrothieno[3,4-c]furan-3-one |
| InChIKey | JMCSZJQCCQAIOI-IYSWYEEDSA-N |
| SMILES | C1[C@@H]2C(=O)OC[C@@]2(CS1)CO |
Computed by PubChem (NCBI)