Products 1358754-78-5
CAS 1358754-78-5 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(4-(p-tolyloxy)phenyl)-1,3,2-dioxaborolane, ≥95%, ≥95%, (4-(P-TOLYLOXY)PHENYL)BORONIC ACID PINACOL ESTER, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-[4-(4-methylphenoxy)phenyl]-1,3,2-dioxaborolane (CAS 1358754-78-5) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(4-methylphenoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: GRIGXGSKZWWIRP-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(4-methylphenoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GRIGXGSKZWWIRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)