CAS 135886-29-2 is the registry number for 3'-β-F-2'-5-Me-dU. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,4R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 135886-29-2) is a chemical compound with the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. IUPAC name: 1-[(2R,4R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: UXCAQJAQSWSNPQ-BWZBUEFSSA-N.
| Molecular formula | C10H13FN2O4 |
|---|---|
| Molecular weight | 244.22 g/mol |
| IUPAC name | 1-[(2R,4R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | UXCAQJAQSWSNPQ-BWZBUEFSSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@H]([C@H](O2)CO)F |
Computed by PubChem (NCBI)