CAS 29705-38-2 appears in our catalog under these names: 2,2'-((4-Fluoro-3-nitrophenyl)azanediyl)diethanol, 98%+,RG, 98%+,RG, 2,2'-((4-Fluoro-3-nitrophenyl)azanediyl)diethanol, 98%+,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
2-[4-fluoro-N-(2-hydroxyethyl)-3-nitroanilino]ethanol (CAS 29705-38-2) is a chemical compound with the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. IUPAC name: 2-[4-fluoro-N-(2-hydroxyethyl)-3-nitroanilino]ethanol. InChIKey: ZZJIOLHDWAXCSE-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O4 |
|---|---|
| Molecular weight | 244.22 g/mol |
| IUPAC name | 2-[4-fluoro-N-(2-hydroxyethyl)-3-nitroanilino]ethanol |
| InChIKey | ZZJIOLHDWAXCSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N(CCO)CCO)[N+](=O)[O-])F |
Computed by PubChem (NCBI)