CAS 135906-34-2 is the registry number for 4,4-Dibenzyl-2-phenyloxazol-5(4H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dibenzyl-2-phenyl-1,3-oxazol-5-one (CAS 135906-34-2) is a chemical compound with the molecular formula C23H19NO2 and a molecular weight of 341.4 g/mol. IUPAC name: 4,4-dibenzyl-2-phenyl-1,3-oxazol-5-one. InChIKey: OWFMOQDESWDIDL-UHFFFAOYSA-N.
| Molecular formula | C23H19NO2 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 4,4-dibenzyl-2-phenyl-1,3-oxazol-5-one |
| InChIKey | OWFMOQDESWDIDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2(C(=O)OC(=N2)C3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)