CAS 340305-03-5 is the registry number for 2-((2,5-Dimethyl-1-(p-tolyl)-1H-pyrrol-3-yl)methylene)-1H-indene-1,3(2H)-dione, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]indene-1,3-dione (CAS 340305-03-5) is a chemical compound with the molecular formula C23H19NO2 and a molecular weight of 341.4 g/mol. IUPAC name: 2-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]indene-1,3-dione. InChIKey: LQZSGLUUMSRGEF-UHFFFAOYSA-N.
| Molecular formula | C23H19NO2 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]indene-1,3-dione |
| InChIKey | LQZSGLUUMSRGEF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=C2C)C=C3C(=O)C4=CC=CC=C4C3=O)C |
Computed by PubChem (NCBI)