Products 135911-02-3
CAS 135911-02-3 appears in our catalog under these names: RP 67580, RP 67580, RP 67580, 99.05%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 50mg, 10 mg, 5 mg, 1mg, 5mg, 25mg, 100mg.
(3aR,7aR)-2-[2-(2-methoxyphenyl)ethanimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one (CAS 135911-02-3) is a chemical compound with the molecular formula C29H30N2O2 and a molecular weight of 438.6 g/mol. IUPAC name: (3aR,7aR)-2-[2-(2-methoxyphenyl)ethanimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one. InChIKey: VWBOQFANCXZMAU-LOSJGSFVSA-N.
| Molecular formula | C29H30N2O2 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | (3aR,7aR)-2-[2-(2-methoxyphenyl)ethanimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| InChIKey | VWBOQFANCXZMAU-LOSJGSFVSA-N |
| SMILES | COC1=CC=CC=C1CC(=N)N2C[C@H]3[C@@H](C2)C(CCC3=O)(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)