Products 62488-09-9
CAS 62488-09-9 is the registry number for 4,4'-((Propane-2,2-diylbis(4,1-phenylene))bis(oxy))bis(2-methylaniline), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4-[4-[2-[4-(4-amino-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]-2-methylaniline (CAS 62488-09-9) is a chemical compound with the molecular formula C29H30N2O2 and a molecular weight of 438.6 g/mol. IUPAC name: 4-[4-[2-[4-(4-amino-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]-2-methylaniline. InChIKey: VIOLICZMLSEPIY-UHFFFAOYSA-N.
| Molecular formula | C29H30N2O2 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | 4-[4-[2-[4-(4-amino-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]-2-methylaniline |
| InChIKey | VIOLICZMLSEPIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC=C(C=C2)C(C)(C)C3=CC=C(C=C3)OC4=CC(=C(C=C4)N)C)N |
Computed by PubChem (NCBI)