CAS 1359833-89-8 is the registry number for N-(9,9-Dimethyl-9H-fluoren-2-yl)dibenzo[b,d]furan-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine (CAS 1359833-89-8) is a chemical compound with the molecular formula C27H21NO and a molecular weight of 375.5 g/mol. IUPAC name: N-(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine. InChIKey: OYCPSCXBBGYBHK-UHFFFAOYSA-N.
| Molecular formula | C27H21NO |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | N-(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine |
| InChIKey | OYCPSCXBBGYBHK-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC5=C(C=C4)OC6=CC=CC=C65)C |
Computed by PubChem (NCBI)