CAS 2413738-47-1 is the registry number for Antitrypanosomal agent 28. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-[2-methyl-4-[(E)-2-phenylethenyl]quinolin-3-yl]-3-phenylprop-2-en-1-one (CAS 2413738-47-1) is a chemical compound with the molecular formula C27H21NO and a molecular weight of 375.5 g/mol. IUPAC name: (E)-1-[2-methyl-4-[(E)-2-phenylethenyl]quinolin-3-yl]-3-phenylprop-2-en-1-one. InChIKey: QFRYTLSPRIQUOO-YWNVXTCZSA-N.
| Molecular formula | C27H21NO |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | (E)-1-[2-methyl-4-[(E)-2-phenylethenyl]quinolin-3-yl]-3-phenylprop-2-en-1-one |
| InChIKey | QFRYTLSPRIQUOO-YWNVXTCZSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1C(=O)/C=C/C3=CC=CC=C3)/C=C/C4=CC=CC=C4 |
Computed by PubChem (NCBI)