Products 1359844-10-2
CAS 1359844-10-2 is the registry number for 2-(4'-Fluoro-[1,1'-biphenyl]-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
2-[4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1359844-10-2) is a chemical compound with the molecular formula C18H20BFO2 and a molecular weight of 298.2 g/mol. IUPAC name: 2-[4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: POVBPKOMIATIEH-UHFFFAOYSA-N.
| Molecular formula | C18H20BFO2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 2-[4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | POVBPKOMIATIEH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)