CAS 269410-15-3 appears in our catalog under these names: 2-Fluoro-4-biphenylboronic acid, pinacol ester, 98%, 2–Fluoro–4–biphenylboronic acid, pinacol ester, 2-Fluoro-4-biphenylboronic acid， pinacol ester, ≥98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
2-(3-fluoro-4-phenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 269410-15-3) is a chemical compound with the molecular formula C18H20BFO2 and a molecular weight of 298.2 g/mol. IUPAC name: 2-(3-fluoro-4-phenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OGXPMMGBQKEWBI-UHFFFAOYSA-N.
| Molecular formula | C18H20BFO2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OGXPMMGBQKEWBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C3=CC=CC=C3)F |
Computed by PubChem (NCBI)