CAS 136050-93-6 is the registry number for N6-Ethyl-2’-deoxyadenosine, 98.84%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg.
(2R,3S,5R)-5-[6-(ethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 136050-93-6) is a chemical compound with the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. IUPAC name: (2R,3S,5R)-5-[6-(ethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: AKVOWIRRIYQYQX-DJLDLDEBSA-N.
| Molecular formula | C12H17N5O3 |
|---|---|
| Molecular weight | 279.30 g/mol |
| IUPAC name | (2R,3S,5R)-5-[6-(ethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | AKVOWIRRIYQYQX-DJLDLDEBSA-N |
| SMILES | CCNC1=C2C(=NC=N1)N(C=N2)[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)