Products 136050-93-6

CAS 136050-93-6 is the registry number for N6-Ethyl-2’-deoxyadenosine, 98.84%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

(2R,3S,5R)-5-[6-(ethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 136050-93-6) is a chemical compound with the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. IUPAC name: (2R,3S,5R)-5-[6-(ethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: AKVOWIRRIYQYQX-DJLDLDEBSA-N.

Identity
Molecular formulaC12H17N5O3
Molecular weight279.30 g/mol
IUPAC name(2R,3S,5R)-5-[6-(ethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol
InChIKeyAKVOWIRRIYQYQX-DJLDLDEBSA-N
SMILESCCNC1=C2C(=NC=N1)N(C=N2)[C@H]3C[C@@H]([C@H](O3)CO)O

Computed by PubChem (NCBI)