Products 3608-60-4
CAS 3608-60-4 is the registry number for 3’-Deoxy-N6-ethyladenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,5S)-2-[6-(ethylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol (CAS 3608-60-4) is a chemical compound with the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. IUPAC name: (2R,3R,5S)-2-[6-(ethylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol. InChIKey: OYNIDVNVEJTGLR-JOAULVNJSA-N.
| Molecular formula | C12H17N5O3 |
|---|---|
| Molecular weight | 279.30 g/mol |
| IUPAC name | (2R,3R,5S)-2-[6-(ethylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
| InChIKey | OYNIDVNVEJTGLR-JOAULVNJSA-N |
| SMILES | CCNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H](C[C@H](O3)CO)O |
Computed by PubChem (NCBI)