Products 1360547-54-1

CAS 1360547-54-1 is the registry number for Cis-n-boc-pyrrolidine-3,4-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O,4-O-diethyl (3S,4R)-pyrrolidine-1,3,4-tricarboxylate (CAS 1360547-54-1) is a chemical compound with the molecular formula C15H25NO6 and a molecular weight of 315.36 g/mol. IUPAC name: 1-O-tert-butyl 3-O,4-O-diethyl (3S,4R)-pyrrolidine-1,3,4-tricarboxylate. InChIKey: QVFYELHUZMOHPV-PHIMTYICSA-N.

Identity
Molecular formulaC15H25NO6
Molecular weight315.36 g/mol
IUPAC name1-O-tert-butyl 3-O,4-O-diethyl (3S,4R)-pyrrolidine-1,3,4-tricarboxylate
InChIKeyQVFYELHUZMOHPV-PHIMTYICSA-N
SMILESCCOC(=O)[C@@H]1CN(C[C@@H]1C(=O)OCC)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)