CAS 1955557-34-2 appears in our catalog under these names: 1,3-Bis((tert-butoxy)carbonyl)pyrrolidine-3-carboxylic acid, 95%, 1,3-Bis((tert-butoxy)carbonyl)pyrrolidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-bis[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1955557-34-2) is a chemical compound with the molecular formula C15H25NO6 and a molecular weight of 315.36 g/mol. IUPAC name: 1,3-bis[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: FKLBGTXGWABOML-UHFFFAOYSA-N.
| Molecular formula | C15H25NO6 |
|---|---|
| Molecular weight | 315.36 g/mol |
| IUPAC name | 1,3-bis[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | FKLBGTXGWABOML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CCN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)