Products 1360599-23-0
CAS 1360599-23-0 is the registry number for 2-(4-(tert-Butyl)phenyl)-1-methyl-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-tert-butylphenyl)-1-methylindole (CAS 1360599-23-0) is a chemical compound with the molecular formula C19H21N and a molecular weight of 263.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-1-methylindole. InChIKey: XORUUTSDVJAQKH-UHFFFAOYSA-N.
| Molecular formula | C19H21N |
|---|---|
| Molecular weight | 263.4 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-1-methylindole |
| InChIKey | XORUUTSDVJAQKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC3=CC=CC=C3N2C |
Computed by PubChem (NCBI)