Products 97961-95-0

CAS 97961-95-0 is the registry number for 2'-Phenylspiro(cyclohexane-1,3'-indoline), 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane] (CAS 97961-95-0) is a chemical compound with the molecular formula C19H21N and a molecular weight of 263.4 g/mol. IUPAC name: 2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane]. InChIKey: HOJHWVXYCZXHLH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21N
Molecular weight263.4 g/mol
IUPAC name2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane]
InChIKeyHOJHWVXYCZXHLH-UHFFFAOYSA-N
SMILESC1CCC2(CC1)C(NC3=CC=CC=C23)C4=CC=CC=C4

Computed by PubChem (NCBI)