Products 1360942-30-8
CAS 1360942-30-8 appears in our catalog under these names: 5-Bromo-6-methyl-1h-indazole-3-carboxylic acid, 95%, 5-Bromo-6-methyl-1H-indazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 100mg, 1g, 500mg.
5-bromo-6-methyl-1H-indazole-3-carboxylic acid (CAS 1360942-30-8) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 5-bromo-6-methyl-1H-indazole-3-carboxylic acid. InChIKey: MMJVFRMSAWBRRG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 5-bromo-6-methyl-1H-indazole-3-carboxylic acid |
| InChIKey | MMJVFRMSAWBRRG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)