CAS 1361112-77-7 is the registry number for N,N-Dimethyl-4-(pyrrolidin-2-yl)pyrimidin-2-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-4-pyrrolidin-2-ylpyrimidin-2-amine;dihydrochloride (CAS 1361112-77-7) is a chemical compound with the molecular formula C10H18Cl2N4 and a molecular weight of 265.18 g/mol. IUPAC name: N,N-dimethyl-4-pyrrolidin-2-ylpyrimidin-2-amine;dihydrochloride. InChIKey: GBYYQWQGMOCQDD-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N4 |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | N,N-dimethyl-4-pyrrolidin-2-ylpyrimidin-2-amine;dihydrochloride |
| InChIKey | GBYYQWQGMOCQDD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=CC(=N1)C2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)