CAS 1432677-75-2 appears in our catalog under these names: 5-(tert-Butylamino)pyridine-2-carboximidamide dihydrochloride, 5-(tert-Butylamino)pyridine-2-carboximidamide dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-(tert-butylamino)pyridine-2-carboximidamide;dihydrochloride (CAS 1432677-75-2) is a chemical compound with the molecular formula C10H18Cl2N4 and a molecular weight of 265.18 g/mol. IUPAC name: 5-(tert-butylamino)pyridine-2-carboximidamide;dihydrochloride. InChIKey: JNKUHAXBBDUWPA-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N4 |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | 5-(tert-butylamino)pyridine-2-carboximidamide;dihydrochloride |
| InChIKey | JNKUHAXBBDUWPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=CN=C(C=C1)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)