Products 1361113-12-3

CAS 1361113-12-3 is the registry number for 1-(2-(4-Fluorophenyl)acetyl)azetidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-[2-(4-fluorophenyl)acetyl]azetidine-3-carboxylic acid (CAS 1361113-12-3) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: 1-[2-(4-fluorophenyl)acetyl]azetidine-3-carboxylic acid. InChIKey: NCOKMECJNPJGNO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FNO3
Molecular weight237.23 g/mol
IUPAC name1-[2-(4-fluorophenyl)acetyl]azetidine-3-carboxylic acid
InChIKeyNCOKMECJNPJGNO-UHFFFAOYSA-N
SMILESC1C(CN1C(=O)CC2=CC=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)