CAS 1361305-36-3 appears in our catalog under these names: 2-Bromo-7-phenyl-9,9'-spirobi[9H-fluorene], 98%, 98%, 7-BROMO-2-PHENYL-9,9'-SPIROBI[FLUORENE], 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2'-bromo-7'-phenyl-9,9'-spirobi[fluorene] (CAS 1361305-36-3) is a chemical compound with the molecular formula C31H19Br and a molecular weight of 471.4 g/mol. IUPAC name: 2'-bromo-7'-phenyl-9,9'-spirobi[fluorene]. InChIKey: OEOURNPHMAJKOF-UHFFFAOYSA-N.
| Molecular formula | C31H19Br |
|---|---|
| Molecular weight | 471.4 g/mol |
| IUPAC name | 2'-bromo-7'-phenyl-9,9'-spirobi[fluorene] |
| InChIKey | OEOURNPHMAJKOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)C4=C(C35C6=CC=CC=C6C7=CC=CC=C57)C=C(C=C4)Br |
Computed by PubChem (NCBI)