CAS 2102016-85-1 is the registry number for 4-Bromo-4'-phenyl-9,9'-spirobi[fluorene], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-4'-phenyl-9,9'-spirobi[fluorene] (CAS 2102016-85-1) is a chemical compound with the molecular formula C31H19Br and a molecular weight of 471.4 g/mol. IUPAC name: 4-bromo-4'-phenyl-9,9'-spirobi[fluorene]. InChIKey: FPZOLKJFLOXAGM-UHFFFAOYSA-N.
| Molecular formula | C31H19Br |
|---|---|
| Molecular weight | 471.4 g/mol |
| IUPAC name | 4-bromo-4'-phenyl-9,9'-spirobi[fluorene] |
| InChIKey | FPZOLKJFLOXAGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C4=CC=CC=C4C5(C3=CC=C2)C6=C(C7=CC=CC=C57)C(=CC=C6)Br |
Computed by PubChem (NCBI)