Products 1361321-96-1
CAS 1361321-96-1 appears in our catalog under these names: ACT-462206, 99+%, ACT-462206/ 99.45% (existing batch purity), ACT 462206, ACT 462206, ACT-462206, 99.45% ,, 99.45% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 200mg.
(2S)-N-(3,5-dimethylphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide (CAS 1361321-96-1) is a chemical compound with the molecular formula C20H24N2O4S and a molecular weight of 388.5 g/mol. IUPAC name: (2S)-N-(3,5-dimethylphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide. InChIKey: NHPQGZOBHSVTAQ-IBGZPJMESA-N.
| Molecular formula | C20H24N2O4S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | (2S)-N-(3,5-dimethylphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
| InChIKey | NHPQGZOBHSVTAQ-IBGZPJMESA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)[C@@H]2CCCN2S(=O)(=O)C3=CC=C(C=C3)OC)C |
Computed by PubChem (NCBI)