Products 940306-33-2
CAS 940306-33-2 appears in our catalog under these names: Penilloic Acids of Nafcillin, NAFCILLIN PENILLOIC ACID. Offered by: TRC, Mikromol, Sigma-Aldrich. Available pack sizes: 25mg, 10MG.
(4S)-2-[[(2-ethoxynaphthalene-1-carbonyl)amino]methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 940306-33-2) is a chemical compound with the molecular formula C20H24N2O4S and a molecular weight of 388.5 g/mol. IUPAC name: (4S)-2-[[(2-ethoxynaphthalene-1-carbonyl)amino]methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: WHHZZRUECRWKAX-LWKPJOBUSA-N.
| Molecular formula | C20H24N2O4S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | (4S)-2-[[(2-ethoxynaphthalene-1-carbonyl)amino]methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | WHHZZRUECRWKAX-LWKPJOBUSA-N |
| SMILES | CCOC1=C(C2=CC=CC=C2C=C1)C(=O)NCC3N[C@H](C(S3)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Nafcillin Impurity 9