CAS 136145-07-8 appears in our catalog under these names: Arofylline, Arofylline/ 97.98% (existing batch purity). Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 1 mg.
3-(4-chlorophenyl)-1-propyl-7H-purine-2,6-dione (CAS 136145-07-8) is a chemical compound with the molecular formula C14H13ClN4O2 and a molecular weight of 304.73 g/mol. IUPAC name: 3-(4-chlorophenyl)-1-propyl-7H-purine-2,6-dione. InChIKey: GVTLDPJNRVMCAL-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4O2 |
|---|---|
| Molecular weight | 304.73 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1-propyl-7H-purine-2,6-dione |
| InChIKey | GVTLDPJNRVMCAL-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(N=CN2)N(C1=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)