CAS 1803593-65-8 appears in our catalog under these names: 5-Methyl-1-(quinolin-6-ylmethyl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride, 95%, 5-Methyl-1-(quinolin-6-ylmethyl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methyl-1-(quinolin-6-ylmethyl)triazole-4-carboxylic acid;hydrochloride (CAS 1803593-65-8) is a chemical compound with the molecular formula C14H13ClN4O2 and a molecular weight of 304.73 g/mol. IUPAC name: 5-methyl-1-(quinolin-6-ylmethyl)triazole-4-carboxylic acid;hydrochloride. InChIKey: CBGAJLXBGYDGBZ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4O2 |
|---|---|
| Molecular weight | 304.73 g/mol |
| IUPAC name | 5-methyl-1-(quinolin-6-ylmethyl)triazole-4-carboxylic acid;hydrochloride |
| InChIKey | CBGAJLXBGYDGBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=CC3=C(C=C2)N=CC=C3)C(=O)O.Cl |
Computed by PubChem (NCBI)