CAS 13615-46-8 is the registry number for Sodium trans-indole-3-acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Sodium (E)-3-(1H-indol-3-yl)prop-2-enoate (CAS 13615-46-8) is a chemical compound with the molecular formula C11H8NNaO2 and a molecular weight of 209.18 g/mol. IUPAC name: sodium (E)-3-(1H-indol-3-yl)prop-2-enoate. InChIKey: RVUGOFHDOUJAQL-IPZCTEOASA-M.
| Molecular formula | C11H8NNaO2 |
|---|---|
| Molecular weight | 209.18 g/mol |
| IUPAC name | sodium (E)-3-(1H-indol-3-yl)prop-2-enoate |
| InChIKey | RVUGOFHDOUJAQL-IPZCTEOASA-M |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)