CAS 17937-06-3 is the registry number for Sodium 8–aminonaphthalene–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 2,5g, 250mg, 50mg, 500mg, 5g.
Sodium 8-aminonaphthalene-1-carboxylate (CAS 17937-06-3) is a chemical compound with the molecular formula C11H8NNaO2 and a molecular weight of 209.18 g/mol. IUPAC name: sodium 8-aminonaphthalene-1-carboxylate. InChIKey: YLELWFAWWRTGQQ-UHFFFAOYSA-M.
| Molecular formula | C11H8NNaO2 |
|---|---|
| Molecular weight | 209.18 g/mol |
| IUPAC name | sodium 8-aminonaphthalene-1-carboxylate |
| InChIKey | YLELWFAWWRTGQQ-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C(=C1)C(=O)[O-])C(=CC=C2)N.[Na+] |
Computed by PubChem (NCBI)