CAS 1361969-01-8 appears in our catalog under these names: (2–(4–(Bromomethyl)phenyl)ethene–1,1,2–triyl)tribenzene, 1,1,2-Triphenyl-2-(4-bromomethylphenyl)ethylene, 98%, 98%, (2-(4-(Bromomethyl)phenyl)ethene-1,1,2-triyl)tribenzene, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
1-(bromomethyl)-4-(1,2,2-triphenylethenyl)benzene (CAS 1361969-01-8) is a chemical compound with the molecular formula C27H21Br and a molecular weight of 425.4 g/mol. IUPAC name: 1-(bromomethyl)-4-(1,2,2-triphenylethenyl)benzene. InChIKey: BCQFLZRLTIZMLQ-UHFFFAOYSA-N.
| Molecular formula | C27H21Br |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(1,2,2-triphenylethenyl)benzene |
| InChIKey | BCQFLZRLTIZMLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)CBr)C4=CC=CC=C4 |
Computed by PubChem (NCBI)