CAS 474918-33-7 appears in our catalog under these names: 2–Bromo–9,9–di–p–tolyl–9H–fluorene, 2-Bromo-9,9-di-p-tolyl-9H-fluorene, >98.0%(GC), 2-Bromo-9,9-di-p-tolyl-9H-fluorene, 98%, 98%, 2-Bromo-9,9-di-p-tolyl-9H-fluorene, 98%. Offered by: GLPBio, TCI, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg.
2-bromo-9,9-bis(4-methylphenyl)fluorene (CAS 474918-33-7) is a chemical compound with the molecular formula C27H21Br and a molecular weight of 425.4 g/mol. IUPAC name: 2-bromo-9,9-bis(4-methylphenyl)fluorene. InChIKey: PUGVEXPXLSEEOS-UHFFFAOYSA-N.
| Molecular formula | C27H21Br |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | 2-bromo-9,9-bis(4-methylphenyl)fluorene |
| InChIKey | PUGVEXPXLSEEOS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(C3=CC=CC=C3C4=C2C=C(C=C4)Br)C5=CC=C(C=C5)C |
Computed by PubChem (NCBI)