CAS 136258-27-0 appears in our catalog under these names: (E)-3-(Adamantan-1-yl)acrylic acid, 95%, (E)-3-Tricyclo(3.3.1.13,7)dec-1-yl-2-propenoic acid, (E)-3-(Adamantan-1-yl)acrylic acid, 95%, 95%, (2E)-3-(ADAMANTAN-1-YL)PROP-2-ENOIC ACID, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
(E)-3-(1-adamantyl)prop-2-enoic acid (CAS 136258-27-0) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: (E)-3-(1-adamantyl)prop-2-enoic acid. InChIKey: MAROXWFNHXFGIU-OWOJBTEDSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (E)-3-(1-adamantyl)prop-2-enoic acid |
| InChIKey | MAROXWFNHXFGIU-OWOJBTEDSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)