Products 1363380-96-4
CAS 1363380-96-4 appears in our catalog under these names: 5-Bromo-1-methyl-1h-indazole-3-carboxylic acid, 95%, 5–Bromo–1–methyl–1H–indazole–3–carboxylic acid, 5-Bromo-1-methyl-1H-indazole-3-carboxylic Acid, 5-Bromo-1-methyl-1H-indazole-3-carboxylic acid, 97%, 97%, 5-Bromo-1-methyl-1H-indazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 2g, 500mg, 10g, 50g.
5-bromo-1-methylindazole-3-carboxylic acid (CAS 1363380-96-4) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 5-bromo-1-methylindazole-3-carboxylic acid. InChIKey: PRXFQVZMBVERDQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 5-bromo-1-methylindazole-3-carboxylic acid |
| InChIKey | PRXFQVZMBVERDQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C(=N1)C(=O)O |
Computed by PubChem (NCBI)