CAS 1363381-55-8 appears in our catalog under these names: 3-Boc-3-azabicyclo[3.1.0]hexane-1-carboxylic acid, 97%, 3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-1-carboxylic acid, 95% (cis), 95% (cis), 3-BOC-3-AZABICYCLO[3.1.0]HEXANE-1-CARBOXYLIC ACID, 95%, cis-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-1-carboxylic acid, 95% (cis). Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid (CAS 1363381-55-8) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid. InChIKey: OUTDFRNFTVGFRQ-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid |
| InChIKey | OUTDFRNFTVGFRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC2(C1)C(=O)O |
Computed by PubChem (NCBI)