Products 1363382-30-2
CAS 1363382-30-2 appears in our catalog under these names: 3-Bromo-1-methyl-1h-indazole-6-carboxylic acid, 95%, 3-Bromo-1-methyl-1H-indazole-6-carboxylic acid, 97%, 3–BROMO–1–METHYL–1H–INDAZOLE–6–CARBOXYLIC ACID. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg.
3-bromo-1-methylindazole-6-carboxylic acid (CAS 1363382-30-2) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 3-bromo-1-methylindazole-6-carboxylic acid. InChIKey: DMDCLOZQWPLXRK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 3-bromo-1-methylindazole-6-carboxylic acid |
| InChIKey | DMDCLOZQWPLXRK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(=O)O)C(=N1)Br |
Computed by PubChem (NCBI)