CAS 1363383-21-4 is the registry number for Methyl 3-bromo-7-hydroxy-1h-indazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 3-bromo-7-hydroxy-2H-indazole-5-carboxylate (CAS 1363383-21-4) is a chemical compound with the molecular formula C9H7BrN2O3 and a molecular weight of 271.07 g/mol. IUPAC name: methyl 3-bromo-7-hydroxy-2H-indazole-5-carboxylate. InChIKey: GXVMPNHKDJZVFC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O3 |
|---|---|
| Molecular weight | 271.07 g/mol |
| IUPAC name | methyl 3-bromo-7-hydroxy-2H-indazole-5-carboxylate |
| InChIKey | GXVMPNHKDJZVFC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(NN=C2C(=C1)O)Br |
Computed by PubChem (NCBI)