CAS 325980-87-8 is the registry number for 5-Bromo-N-(5-methylisoxazol-3-yl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide (CAS 325980-87-8) is a chemical compound with the molecular formula C9H7BrN2O3 and a molecular weight of 271.07 g/mol. IUPAC name: 5-bromo-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide. InChIKey: RSQZXOFVURQUAP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O3 |
|---|---|
| Molecular weight | 271.07 g/mol |
| IUPAC name | 5-bromo-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide |
| InChIKey | RSQZXOFVURQUAP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)