CAS 1363402-35-0 appears in our catalog under these names: (2S)-1-[(Tert-Butoxy)Carbonyl]-2-Methylazetidine-2-Carboxylic Acid, >95%, >95%, (2S)-1-[(tert-Butoxy)carbonyl]-2-methylazetidine-2-carboxylic acid, 97.10%, (2S)-1-[(tert-Butoxy)carbonyl]-2-methylazetidine-2-carboxylic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 250 mg, 100 mg, 1 g, 500 mg.
(2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 1363402-35-0) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: (2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: HFEGSFBKYUXELG-JTQLQIEISA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | HFEGSFBKYUXELG-JTQLQIEISA-N |
| SMILES | C[C@]1(CCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)