CAS 449758-77-4 appears in our catalog under these names: 1-(tert-Butoxycarbonyl)-2-methylazetidine-2-carboxylic acid, 95%, 1–(tert–Butoxycarbonyl)–2–methylazetidine–2–carboxylic acid, 1-(tert-Butoxycarbonyl)-2-methylazetidine-2-carboxylic acid, 95%, 95%, 1-(tert-Butoxycarbonyl)-2-methylazetidine-2-carboxylic acid, 97%, 2-Methyl-1,2-azetidinedicarboxylic acid 1-(1,1-dimethylethyl) ester, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g.
2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 449758-77-4) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: HFEGSFBKYUXELG-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | HFEGSFBKYUXELG-UHFFFAOYSA-N |
| SMILES | CC1(CCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)