CAS 13638-82-9 appears in our catalog under these names: 1,3,6,8-Tetraphenylpyrene, 95%, 1,3,6,8–Tetraphenylpyrene, 1,3,6,8-Tetraphenylpyrene, >98.0%(HPLC), Pyrene,1,3,6,8-tetraphenyl-, 98%, 98%, 1,3,6,8-Tetraphenylpyrene, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 50mg, 200mg, 1g, 250mg, 100mg, 5g.
1,3,6,8-tetraphenylpyrene (CAS 13638-82-9) is a chemical compound with the molecular formula C40H26 and a molecular weight of 506.6 g/mol. IUPAC name: 1,3,6,8-tetraphenylpyrene. InChIKey: SIJHJHYRYHIWFW-UHFFFAOYSA-N.
| Molecular formula | C40H26 |
|---|---|
| Molecular weight | 506.6 g/mol |
| IUPAC name | 1,3,6,8-tetraphenylpyrene |
| InChIKey | SIJHJHYRYHIWFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)